C19H20FN3O3S2 — CID 11750540
(2R,3R,4S,5S)-4-azido-5-fluoro-2-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxan-3-ol (PubChem CID 11750540) has the molecular formula C19H20FN3O3S2 and a molecular weight of 421.52 g/mol. Its IUPAC name is (2R,3R,4S,5S)-4-azido-5-fluoro-2-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxan-3-ol.
| Compound Name | (2R,3R,4S,5S)-4-azido-5-fluoro-2-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxan-3-ol |
|---|---|
| PubChem CID | 11750540 |
| Molecular Formula | C19H20FN3O3S2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (2R,3R,4S,5S)-4-azido-5-fluoro-2-[(1R)-1-hydroxy-2,2-bis(phenylsulfanyl)ethyl]oxan-3-ol |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H](O)[C@H]([C@@H](O)C(Sc2ccccc2)Sc2ccccc2)OC[C@H]1F |
| InChI | InChI=1S/C19H20FN3O3S2/c20-14-11-26-18(16(24)15(14)22-23-21)17(25)19(27-12-7-3-1-4-8-12)28-13-9-5-2-6-10-13/h1-10,14-19,24-25H,11H2/t14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | ZTAPWLWCGLARGQ-DUQPFJRNSA-N |
| XLogP | 4.03 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|