C24H50O4Si — CID 11750793
(2S,3S,4S)-2-methyl-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pentane-1,3-diol (PubChem CID 11750793) has the molecular formula C24H50O4Si and a molecular weight of 430.75 g/mol. Its IUPAC name is (2S,3S,4S)-2-methyl-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pentane-1,3-diol.
| Compound Name | (2S,3S,4S)-2-methyl-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pentane-1,3-diol |
|---|---|
| PubChem CID | 11750793 |
| Molecular Formula | C24H50O4Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.35 |
| IUPAC Name | (2S,3S,4S)-2-methyl-4-[(2S,3S,6S)-3-methyl-6-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]oxan-2-yl]pentane-1,3-diol |
| SMILES | CC(C)[Si](OC[C@@H](C)[C@@H]1CC[C@H](C)[C@@H]([C@@H](C)[C@@H](O)[C@@H](C)CO)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H50O4Si/c1-15(2)29(16(3)4,17(5)6)27-14-20(9)22-12-11-18(7)24(28-22)21(10)23(26)19(8)13-25/h15-26H,11-14H2,1-10H3/t18-,19-,20+,21-,22-,23-,24-/m0/s1 |
| InChIKey | VTXNWQIIUIKFRQ-JDAKRHAISA-N |
| XLogP | 5.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|