C25H40O5Si — CID 11751263
diethyl 2-[(E)-4-[[(1E)-3-methylbuta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate (PubChem CID 11751263) has the molecular formula C25H40O5Si and a molecular weight of 448.68 g/mol. Its IUPAC name is diethyl 2-[(E)-4-[[(1E)-3-methylbuta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate.
| Compound Name | diethyl 2-[(E)-4-[[(1E)-3-methylbuta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 11751263 |
| Molecular Formula | C25H40O5Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | diethyl 2-[(E)-4-[[(1E)-3-methylbuta-1,3-dienyl]-di(propan-2-yl)silyl]oxybut-2-enyl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(C/C=C/CO[Si](/C=C/C(=C)C)(C(C)C)C(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H40O5Si/c1-10-16-25(23(26)28-11-2,24(27)29-12-3)17-13-14-18-30-31(21(6)7,22(8)9)19-15-20(4)5/h1,13-15,19,21-22H,4,11-12,16-18H2,2-3,5-9H3/b14-13+,19-15+ |
| InChIKey | BMIWTSNGJXYLBM-MNOJGGAQSA-N |
| XLogP | 5.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|