C25H46O3Si2 — CID 11751320
(2S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-4,7-diyn-6-one (PubChem CID 11751320) has the molecular formula C25H46O3Si2 and a molecular weight of 450.81 g/mol. Its IUPAC name is (2S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-4,7-diyn-6-one.
| Compound Name | (2S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-4,7-diyn-6-one |
|---|---|
| PubChem CID | 11751320 |
| Molecular Formula | C25H46O3Si2 |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (2S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]trideca-4,7-diyn-6-one |
| SMILES | CCC[C@@H](CC#CC(=O)C#CC[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O3Si2/c1-13-16-23(28-30(11,12)25(6,7)8)20-15-19-22(26)18-14-17-21(2)27-29(9,10)24(3,4)5/h21,23H,13,16-17,20H2,1-12H3/t21-,23-/m0/s1 |
| InChIKey | AXVYQMWVWGEJSA-GMAHTHKFSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|