C30H52O3 — CID 11751542
2-[(1S,3aR,3bS,5aR,9aS,9bR,11aS)-1-[4-[(2S)-3,3-dimethyloxiran-2-yl]butan-2-yl]-3a,9b,11a-trimethyl-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol (PubChem CID 11751542) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is 2-[(1S,3aR,3bS,5aR,9aS,9bR,11aS)-1-[4-[(2S)-3,3-dimethyloxiran-2-yl]butan-2-yl]-3a,9b,11a-trimethyl-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol.
| Compound Name | 2-[(1S,3aR,3bS,5aR,9aS,9bR,11aS)-1-[4-[(2S)-3,3-dimethyloxiran-2-yl]butan-2-yl]-3a,9b,11a-trimethyl-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol |
|---|---|
| PubChem CID | 11751542 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | 2-[(1S,3aR,3bS,5aR,9aS,9bR,11aS)-1-[4-[(2S)-3,3-dimethyloxiran-2-yl]butan-2-yl]-3a,9b,11a-trimethyl-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol |
| SMILES | CC(CC[C@@H]1OC1(C)C)[C@@H]1CC[C@]2(C)[C@H]3CC[C@@]4(C(C)(C)O)OCCC[C@H]4[C@]3(C)CC[C@@]12C |
| InChI | InChI=1S/C30H52O3/c1-20(11-12-24-25(2,3)33-24)21-13-15-29(8)22-14-16-30(26(4,5)31)23(10-9-19-32-30)27(22,6)17-18-28(21,29)7/h20-24,31H,9-19H2,1-8H3/t20?,21-,22-,23-,24-,27+,28-,29+,30+/m0/s1 |
| InChIKey | WWWOCVBEDWYMAJ-YAQWLZITSA-N |
| XLogP | 7.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|