C18H18ClF5N6O — CID 11751632
[4-chloro-5-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide (PubChem CID 11751632) has the molecular formula C18H18ClF5N6O and a molecular weight of 464.83 g/mol. Its IUPAC name is [4-chloro-5-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide.
| Compound Name | [4-chloro-5-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide |
|---|---|
| PubChem CID | 11751632 |
| Molecular Formula | C18H18ClF5N6O |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [4-chloro-5-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-6-(2,2,2-trifluoroethylamino)pyrimidin-2-yl]-methylcyanamide |
| SMILES | CN(C)CCOc1cc(F)c(-c2c(Cl)nc(N(C)C#N)nc2NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C18H18ClF5N6O/c1-29(2)4-5-31-10-6-11(20)13(12(21)7-10)14-15(19)27-17(30(3)9-25)28-16(14)26-8-18(22,23)24/h6-7H,4-5,8H2,1-3H3,(H,26,27,28) |
| InChIKey | UGCOTKFGCFLGSC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|