C20H21ClN4O5S2 — CID 11752337
3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide (PubChem CID 11752337) has the molecular formula C20H21ClN4O5S2 and a molecular weight of 497.00 g/mol. Its IUPAC name is 3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide.
| Compound Name | 3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11752337 |
| Molecular Formula | C20H21ClN4O5S2 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-methoxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide |
| SMILES | CO/N=C(\C)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl |
| InChI | InChI=1S/C20H21ClN4O5S2/c1-10-8-11(2)17(14(9-10)12(3)23-29-5)22-19(26)18-15(6-7-31-18)32(27,28)25-20-16(21)13(4)24-30-20/h6-9,25H,1-5H3,(H,22,26)/b23-12+ |
| InChIKey | QHCDKIYWFSTMGT-FSJBWODESA-N |
| XLogP | 4.74 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|