C22H28Cl4N4O — CID 11752496
4-(5,6-dichloro-1-propan-2-ylbenzimidazol-2-yl)-N-[2-(propan-2-ylamino)ethyl]benzamide;dihydrochloride (PubChem CID 11752496) has the molecular formula C22H28Cl4N4O and a molecular weight of 506.31 g/mol. Its IUPAC name is 4-(5,6-dichloro-1-propan-2-ylbenzimidazol-2-yl)-N-[2-(propan-2-ylamino)ethyl]benzamide;dihydrochloride.
| Compound Name | 4-(5,6-dichloro-1-propan-2-ylbenzimidazol-2-yl)-N-[2-(propan-2-ylamino)ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 11752496 |
| Molecular Formula | C22H28Cl4N4O |
| Molecular Weight | 506.31 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-(5,6-dichloro-1-propan-2-ylbenzimidazol-2-yl)-N-[2-(propan-2-ylamino)ethyl]benzamide;dihydrochloride |
| SMILES | CC(C)NCCNC(=O)c1ccc(-c2nc3cc(Cl)c(Cl)cc3n2C(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C22H26Cl2N4O.2ClH/c1-13(2)25-9-10-26-22(29)16-7-5-15(6-8-16)21-27-19-11-17(23)18(24)12-20(19)28(21)14(3)4;;/h5-8,11-14,25H,9-10H2,1-4H3,(H,26,29);2*1H |
| InChIKey | PMXAMUZBFIDYRF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.31 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|