C27H58O4Si3 — CID 11752921
(E,4S,5S,7S)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enal (PubChem CID 11752921) has the molecular formula C27H58O4Si3 and a molecular weight of 531.02 g/mol. Its IUPAC name is (E,4S,5S,7S)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enal.
| Compound Name | (E,4S,5S,7S)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enal |
|---|---|
| PubChem CID | 11752921 |
| Molecular Formula | C27H58O4Si3 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | (E,4S,5S,7S)-4,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methyloct-2-enal |
| SMILES | C/C(C=O)=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H58O4Si3/c1-21(20-28)18-23(30-33(14,15)26(6,7)8)24(31-34(16,17)27(9,10)11)19-22(2)29-32(12,13)25(3,4)5/h18,20,22-24H,19H2,1-17H3/b21-18+/t22-,23-,24-/m0/s1 |
| InChIKey | VMVBZYWSKKMQCV-REEIYBNGSA-N |
| XLogP | 8.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|