About 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole
3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole (PubChem CID 11752958) has the molecular formula C36H27N3O2
and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole.
Molecular Properties
| Compound Name | 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole |
| PubChem CID | 11752958 |
| Molecular Formula | C36H27N3O2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1-c1nc(-c2ccc(Oc3ccccc3)cc2)c(-c2ccc(Oc3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C36H27N3O2/c1-24-33(31-14-8-9-15-32(31)37-24)36-38-34(25-16-20-29(21-17-25)40-27-10-4-2-5-11-27)35(39-36)26-18-22-30(23-19-26)41-28-12-6-3-7-13-28/h2-23,37H,1H3,(H,38,39) |
| InChIKey | SFOJNAZYAVZEBZ-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole?
The IUPAC name of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole (CID 11752958) is 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole.
What is the SMILES notation for 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole?
The canonical SMILES for 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole is Cc1[nH]c2ccccc2c1-c1nc(-c2ccc(Oc3ccccc3)cc2)c(-c2ccc(Oc3ccccc3)cc2)[nH]1.
What is the InChIKey of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole?
The InChIKey is SFOJNAZYAVZEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H27N3O2/c1-24-33(31-14-8-9-15-32(31)37-24)36-38-34(25-16-20-29(21-17-25)40-27-10-4-2-5-11-27)35(39-36)26-18-22-30(23-19-26)41-28-12-6-3-7-13-28/h2-23,37H,1H3,(H,38,39).
What are the key properties of 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole?
3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole has a molecular weight of 533.63 g/mol, XLogP of 9.79, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4,5-bis(4-phenoxyphenyl)-1H-imidazol-2-yl]-2-methyl-1H-indole is sourced from PubChem (CID 11752958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).