C17H12F6O9S2 — CID 11753017
methyl 3-methoxy-4-(trifluoromethylsulfonyloxy)-5-[2-(trifluoromethylsulfonyloxy)phenyl]benzoate (PubChem CID 11753017) has the molecular formula C17H12F6O9S2 and a molecular weight of 538.40 g/mol. Its IUPAC name is methyl 3-methoxy-4-(trifluoromethylsulfonyloxy)-5-[2-(trifluoromethylsulfonyloxy)phenyl]benzoate.
| Compound Name | methyl 3-methoxy-4-(trifluoromethylsulfonyloxy)-5-[2-(trifluoromethylsulfonyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 11753017 |
| Molecular Formula | C17H12F6O9S2 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | methyl 3-methoxy-4-(trifluoromethylsulfonyloxy)-5-[2-(trifluoromethylsulfonyloxy)phenyl]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OS(=O)(=O)C(F)(F)F)c(-c2ccccc2OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F6O9S2/c1-29-13-8-9(15(24)30-2)7-11(14(13)32-34(27,28)17(21,22)23)10-5-3-4-6-12(10)31-33(25,26)16(18,19)20/h3-8H,1-2H3 |
| InChIKey | RUWQZVYBPTZGPA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|