C32H48O5Si — CID 11753052
methyl (E)-3-[(2R,4Z,8R,9R)-4,8-dimethyl-2-[(1E,3E)-2-methyl-4-phenylmethoxybuta-1,3-dienyl]-8-triethylsilyloxy-3,6,7,9-tetrahydro-2H-oxonin-9-yl]prop-2-enoate (PubChem CID 11753052) has the molecular formula C32H48O5Si and a molecular weight of 540.82 g/mol. Its IUPAC name is methyl (E)-3-[(2R,4Z,8R,9R)-4,8-dimethyl-2-[(1E,3E)-2-methyl-4-phenylmethoxybuta-1,3-dienyl]-8-triethylsilyloxy-3,6,7,9-tetrahydro-2H-oxonin-9-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,4Z,8R,9R)-4,8-dimethyl-2-[(1E,3E)-2-methyl-4-phenylmethoxybuta-1,3-dienyl]-8-triethylsilyloxy-3,6,7,9-tetrahydro-2H-oxonin-9-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11753052 |
| Molecular Formula | C32H48O5Si |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | methyl (E)-3-[(2R,4Z,8R,9R)-4,8-dimethyl-2-[(1E,3E)-2-methyl-4-phenylmethoxybuta-1,3-dienyl]-8-triethylsilyloxy-3,6,7,9-tetrahydro-2H-oxonin-9-yl]prop-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC/C=C(/C)C[C@H](/C=C(C)/C=C/OCc2ccccc2)O[C@@H]1/C=C/C(=O)OC |
| InChI | InChI=1S/C32H48O5Si/c1-8-38(9-2,10-3)37-32(6)21-14-15-26(4)23-29(36-30(32)18-19-31(33)34-7)24-27(5)20-22-35-25-28-16-12-11-13-17-28/h11-13,15-20,22,24,29-30H,8-10,14,21,23,25H2,1-7H3/b19-18+,22-20+,26-15-,27-24+/t29-,30-,32-/m1/s1 |
| InChIKey | HIXKGBNYVDJUFC-MJKNRIAPSA-N |
| XLogP | 8.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|