C22H35N7O7S2 — CID 11753451
(2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 11753451) has the molecular formula C22H35N7O7S2 and a molecular weight of 573.70 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 11753451 |
| Molecular Formula | C22H35N7O7S2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)O)C(C)C |
| InChI | InChI=1S/C22H35N7O7S2/c1-10(2)17(21(34)28-16(8-38)22(35)36)29-18(31)11(3)25-19(32)14(5-13-6-23-9-24-13)27-20(33)15(7-37)26-12(4)30/h6,9-11,14-17,37-38H,5,7-8H2,1-4H3,(H,23,24)(H,25,32)(H,26,30)(H,27,33)(H,28,34)(H,29,31)(H,35,36)/t11-,14-,15-,16-,17-/m0/s1 |
| InChIKey | XJOGURPGAZYYJL-BXBUPLCLSA-N |
| XLogP | -1.98 |
| TPSA | 211.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|