C38H38O5 — CID 11753456
[(1R,2S,3R,4R,5R)-4-ethoxy-3-hydroxy-2,5-bis(4-methylbenzoyl)-3-(4-methylphenyl)cyclopentyl]-(4-methylphenyl)methanone (PubChem CID 11753456) has the molecular formula C38H38O5 and a molecular weight of 574.72 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-4-ethoxy-3-hydroxy-2,5-bis(4-methylbenzoyl)-3-(4-methylphenyl)cyclopentyl]-(4-methylphenyl)methanone.
| Compound Name | [(1R,2S,3R,4R,5R)-4-ethoxy-3-hydroxy-2,5-bis(4-methylbenzoyl)-3-(4-methylphenyl)cyclopentyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 11753456 |
| Molecular Formula | C38H38O5 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-4-ethoxy-3-hydroxy-2,5-bis(4-methylbenzoyl)-3-(4-methylphenyl)cyclopentyl]-(4-methylphenyl)methanone |
| SMILES | CCO[C@@H]1[C@H](C(=O)c2ccc(C)cc2)[C@@H](C(=O)c2ccc(C)cc2)[C@H](C(=O)c2ccc(C)cc2)[C@@]1(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C38H38O5/c1-6-43-37-32(35(40)28-17-9-24(3)10-18-28)31(34(39)27-15-7-23(2)8-16-27)33(36(41)29-19-11-25(4)12-20-29)38(37,42)30-21-13-26(5)14-22-30/h7-22,31-33,37,42H,6H2,1-5H3/t31-,32+,33-,37-,38+/m1/s1 |
| InChIKey | AELHWRUVZJTTOG-FNHWADJMSA-N |
| XLogP | 7.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |