C36H48O6Si — CID 11753738
ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate (PubChem CID 11753738) has the molecular formula C36H48O6Si and a molecular weight of 604.86 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11753738 |
| Molecular Formula | C36H48O6Si |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | ethyl (E)-3-[(2R,5S,6S,9R)-2-tert-butyl-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-9-methyl-4-oxo-1,3-dioxaspiro[4.5]dec-7-en-6-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H]1C=C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)C[C@]12O[C@@H](C(C)(C)C)OC2=O |
| InChI | InChI=1S/C36H48O6Si/c1-10-39-31(37)25(2)21-28-22-27(26(3)23-36(28)32(38)41-33(42-36)34(4,5)6)24-40-43(35(7,8)9,29-17-13-11-14-18-29)30-19-15-12-16-20-30/h11-22,26,28,33H,10,23-24H2,1-9H3/b25-21+/t26-,28-,33+,36+/m1/s1 |
| InChIKey | KOVQEPDTCRCVAJ-UOJXTBNSSA-N |
| XLogP | 6.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|