About 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine
1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 11754128) has the molecular formula C18H18F5N3O2
and a molecular weight of 403.35 g/mol. Its IUPAC name is 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine.
Molecular Properties
| Compound Name | 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine |
| PubChem CID | 11754128 |
| Molecular Formula | C18H18F5N3O2 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | Fc1cccc(F)c1OCCOc1nc(N2CCNCC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H18F5N3O2/c19-13-2-1-3-14(20)16(13)27-10-11-28-17-12(18(21,22)23)4-5-15(25-17)26-8-6-24-7-9-26/h1-5,24H,6-11H2 |
| InChIKey | OBLMRDRFYUMUQH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine?
The IUPAC name of 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine (CID 11754128) is 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine.
What is the SMILES notation for 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine?
The canonical SMILES for 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine is Fc1cccc(F)c1OCCOc1nc(N2CCNCC2)ccc1C(F)(F)F.
What is the InChIKey of 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine?
The InChIKey is OBLMRDRFYUMUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F5N3O2/c19-13-2-1-3-14(20)16(13)27-10-11-28-17-12(18(21,22)23)4-5-15(25-17)26-8-6-24-7-9-26/h1-5,24H,6-11H2.
What are the key properties of 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine?
1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine has a molecular weight of 403.35 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[2-(2,6-difluorophenoxy)ethoxy]-5-(trifluoromethyl)-2-pyridinyl]piperazine is sourced from PubChem (CID 11754128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).