About 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol
4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol (PubChem CID 11754391) has the molecular formula C29H28N2O4
and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol |
| PubChem CID | 11754391 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol |
| SMILES | COc1c(C/C=C(\C)CO)c(-c2c[nH]c3ccccc23)c(OC)c(O)c1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H28N2O4/c1-17(16-32)12-13-20-25(21-14-30-23-10-6-4-8-18(21)23)29(35-3)27(33)26(28(20)34-2)22-15-31-24-11-7-5-9-19(22)24/h4-12,14-15,30-33H,13,16H2,1-3H3/b17-12+ |
| InChIKey | WFEYRYIESDXIIL-SFQUDFHCSA-N |
| XLogP | 6.19 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol?
The IUPAC name of 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol (CID 11754391) is 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol.
What is the SMILES notation for 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol?
The canonical SMILES for 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol is COc1c(C/C=C(\C)CO)c(-c2c[nH]c3ccccc23)c(OC)c(O)c1-c1c[nH]c2ccccc12.
What is the InChIKey of 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol?
The InChIKey is WFEYRYIESDXIIL-SFQUDFHCSA-N. The full InChI is InChI=1S/C29H28N2O4/c1-17(16-32)12-13-20-25(21-14-30-23-10-6-4-8-18(21)23)29(35-3)27(33)26(28(20)34-2)22-15-31-24-11-7-5-9-19(22)24/h4-12,14-15,30-33H,13,16H2,1-3H3/b17-12+.
What are the key properties of 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol?
4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol has a molecular weight of 468.55 g/mol, XLogP of 6.19, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-4-hydroxy-3-methylbut-2-enyl]-2,5-bis(1H-indol-3-yl)-3,6-dimethoxyphenol is sourced from PubChem (CID 11754391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).