C30H30O5 — CID 11754477
methyl (1S,5R,7R)-6-methyl-6-(4-methylpent-3-enyl)-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate (PubChem CID 11754477) has the molecular formula C30H30O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is methyl (1S,5R,7R)-6-methyl-6-(4-methylpent-3-enyl)-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate.
| Compound Name | methyl (1S,5R,7R)-6-methyl-6-(4-methylpent-3-enyl)-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate |
|---|---|
| PubChem CID | 11754477 |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | methyl (1S,5R,7R)-6-methyl-6-(4-methylpent-3-enyl)-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)[C@@]3(C(=O)OC[C@@H]3C1(C)CCC=C(C)C)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C30H30O5/c1-19(2)12-11-17-28(3)22-18-35-26(32)29(22)23(20-13-7-5-8-14-20)24(21-15-9-6-10-16-21)30(28,25(29)31)27(33)34-4/h5-10,12-16,22H,11,17-18H2,1-4H3/t22-,28?,29+,30+/m1/s1 |
| InChIKey | NDURQDLZEMUANZ-DBEFHKCHSA-N |
| XLogP | 5.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|