C25H50O6Si — CID 11754676
(6E,8S,9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8,11-bis(methoxymethoxy)-2,6-dimethylundeca-1,6-dien-3-ol (PubChem CID 11754676) has the molecular formula C25H50O6Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (6E,8S,9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8,11-bis(methoxymethoxy)-2,6-dimethylundeca-1,6-dien-3-ol.
| Compound Name | (6E,8S,9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8,11-bis(methoxymethoxy)-2,6-dimethylundeca-1,6-dien-3-ol |
|---|---|
| PubChem CID | 11754676 |
| Molecular Formula | C25H50O6Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.34 |
| IUPAC Name | (6E,8S,9R)-9-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8,11-bis(methoxymethoxy)-2,6-dimethylundeca-1,6-dien-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C/[C@@H](OCOC)[C@H](CCOCOC)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O6Si/c1-20(2)23(26)12-11-21(3)17-24(30-19-28-8)22(13-15-29-18-27-7)14-16-31-32(9,10)25(4,5)6/h17,22-24,26H,1,11-16,18-19H2,2-10H3/b21-17+/t22-,23?,24-/m1/s1 |
| InChIKey | WZSPIXUHKCYWJF-HEKPJGJASA-N |
| XLogP | 5.68 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|