C22H28F3N7O2 — CID 11754850
1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 11754850) has the molecular formula C22H28F3N7O2 and a molecular weight of 479.51 g/mol. Its IUPAC name is 1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 11754850 |
| Molecular Formula | C22H28F3N7O2 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CC(C)(C)c1nc(N2CCN(CCCCn3cc(C#N)c(=O)[nH]c3=O)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H28F3N7O2/c1-21(2,3)19-27-16(22(23,24)25)12-17(28-19)31-10-8-30(9-11-31)6-4-5-7-32-14-15(13-26)18(33)29-20(32)34/h12,14H,4-11H2,1-3H3,(H,29,33,34) |
| InChIKey | UHBDOJLDXNFRPT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|