About [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate
[3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate (PubChem CID 11755009) has the molecular formula C30H42O5
and a molecular weight of 482.66 g/mol. Its IUPAC name is [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate.
Molecular Properties
| Compound Name | [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate |
| PubChem CID | 11755009 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1cc(O)cc(CCCCCCC/C=C\CCCCCCCc2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C30H42O5/c1-24(31)35-30-21-26(20-29(34)23-30)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-25-18-27(32)22-28(33)19-25/h2-3,18-23,32-34H,4-17H2,1H3/b3-2- |
| InChIKey | CATXXSJNZBRPTC-IHWYPQMZSA-N |
| XLogP | 7.75 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate?
The IUPAC name of [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate (CID 11755009) is [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate.
What is the SMILES notation for [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate?
The canonical SMILES for [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate is CC(=O)Oc1cc(O)cc(CCCCCCC/C=C\CCCCCCCc2cc(O)cc(O)c2)c1.
What is the InChIKey of [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate?
The InChIKey is CATXXSJNZBRPTC-IHWYPQMZSA-N. The full InChI is InChI=1S/C30H42O5/c1-24(31)35-30-21-26(20-29(34)23-30)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-25-18-27(32)22-28(33)19-25/h2-3,18-23,32-34H,4-17H2,1H3/b3-2-.
What are the key properties of [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate?
[3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate has a molecular weight of 482.66 g/mol, XLogP of 7.75, 17 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(Z)-16-(3,5-dihydroxyphenyl)hexadec-8-enyl]-5-hydroxyphenyl] acetate is sourced from PubChem (CID 11755009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).