C32H29O3P — CID 11755404
5,5-dimethyl-1-phenyl-3-(triphenyl-λ5-phosphanylidene)hexane-1,2,4-trione (PubChem CID 11755404) has the molecular formula C32H29O3P and a molecular weight of 492.56 g/mol. Its IUPAC name is 5,5-dimethyl-1-phenyl-3-(triphenyl-λ5-phosphanylidene)hexane-1,2,4-trione.
| Compound Name | 5,5-dimethyl-1-phenyl-3-(triphenyl-λ5-phosphanylidene)hexane-1,2,4-trione |
|---|---|
| PubChem CID | 11755404 |
| Molecular Formula | C32H29O3P |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 5,5-dimethyl-1-phenyl-3-(triphenyl-λ5-phosphanylidene)hexane-1,2,4-trione |
| SMILES | CC(C)(C)C(=O)C(C(=O)C(=O)c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29O3P/c1-32(2,3)31(35)30(29(34)28(33)24-16-8-4-9-17-24)36(25-18-10-5-11-19-25,26-20-12-6-13-21-26)27-22-14-7-15-23-27/h4-23H,1-3H3 |
| InChIKey | LYMSCLDGSMCCDK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|