C23H28N6O7 — CID 11755699
(2S,3R,4S)-2-(dimethoxymethyl)-4-[4-hydroxy-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-methyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 11755699) has the molecular formula C23H28N6O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is (2S,3R,4S)-2-(dimethoxymethyl)-4-[4-hydroxy-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-methyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (2S,3R,4S)-2-(dimethoxymethyl)-4-[4-hydroxy-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 11755699 |
| Molecular Formula | C23H28N6O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (2S,3R,4S)-2-(dimethoxymethyl)-4-[4-hydroxy-2-methyl-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@H](N(Cc2nnn(C)n2)c2ccc(O)cc2C)[C@H]1O |
| InChI | InChI=1S/C23H28N6O7/c1-13-10-15(30)7-8-17(13)28(12-19-24-26-27(3)25-19)20-16-11-14(29(32)33)6-9-18(16)36-23(2,21(20)31)22(34-4)35-5/h6-11,20-22,30-31H,12H2,1-5H3/t20-,21+,23-/m0/s1 |
| InChIKey | TXGDEIBTPLRMNQ-XJUOHMSHSA-N |
| XLogP | 2.01 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|