C29H32FN5O2 — CID 11755761
2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-8-(3-morpholin-4-ylpropoxy)-4-N-phenylquinazoline-2,4-diamine (PubChem CID 11755761) has the molecular formula C29H32FN5O2 and a molecular weight of 501.61 g/mol. Its IUPAC name is 2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-8-(3-morpholin-4-ylpropoxy)-4-N-phenylquinazoline-2,4-diamine.
| Compound Name | 2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-8-(3-morpholin-4-ylpropoxy)-4-N-phenylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 11755761 |
| Molecular Formula | C29H32FN5O2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 2-N-(4-fluoro-2-methylphenyl)-4-N-methyl-8-(3-morpholin-4-ylpropoxy)-4-N-phenylquinazoline-2,4-diamine |
| SMILES | Cc1cc(F)ccc1Nc1nc(N(C)c2ccccc2)c2cccc(OCCCN3CCOCC3)c2n1 |
| InChI | InChI=1S/C29H32FN5O2/c1-21-20-22(30)12-13-25(21)31-29-32-27-24(28(33-29)34(2)23-8-4-3-5-9-23)10-6-11-26(27)37-17-7-14-35-15-18-36-19-16-35/h3-6,8-13,20H,7,14-19H2,1-2H3,(H,31,32,33) |
| InChIKey | GBZQSQRLFZGYMR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|