C33H43NO3 — CID 11755765
(1S,2R,7R,11S,14S)-18-[(E)-3,3-dimethylbut-1-enyl]-1,2-dimethyl-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaene-8,11-diol (PubChem CID 11755765) has the molecular formula C33H43NO3 and a molecular weight of 501.71 g/mol. Its IUPAC name is (1S,2R,7R,11S,14S)-18-[(E)-3,3-dimethylbut-1-enyl]-1,2-dimethyl-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaene-8,11-diol.
| Compound Name | (1S,2R,7R,11S,14S)-18-[(E)-3,3-dimethylbut-1-enyl]-1,2-dimethyl-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaene-8,11-diol |
|---|---|
| PubChem CID | 11755765 |
| Molecular Formula | C33H43NO3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | (1S,2R,7R,11S,14S)-18-[(E)-3,3-dimethylbut-1-enyl]-1,2-dimethyl-7-prop-1-en-2-yl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaene-8,11-diol |
| SMILES | C=C(C)[C@H]1OC2CC[C@@]3(C)[C@@](O)(CC[C@H]4Cc5c([nH]c6cccc(/C=C/C(C)(C)C)c56)[C@@]43C)C2=CC1O |
| InChI | InChI=1S/C33H43NO3/c1-19(2)28-25(35)18-23-26(37-28)13-15-31(6)32(7)21(12-16-33(23,31)36)17-22-27-20(11-14-30(3,4)5)9-8-10-24(27)34-29(22)32/h8-11,14,18,21,25-26,28,34-36H,1,12-13,15-17H2,2-7H3/b14-11+/t21-,25?,26?,28+,31+,32+,33+/m0/s1 |
| InChIKey | GXBFZIQAXHLFKX-WWERICNKSA-N |
| XLogP | 6.61 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|