C28H38O8 — CID 11755794
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-[[2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]oxy]acetate (PubChem CID 11755794) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-[[2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]oxy]acetate.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-[[2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]oxy]acetate |
|---|---|
| PubChem CID | 11755794 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-[[2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]oxy]acetate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC(=O)COC2=C(O)C(=O)OC2C(O)CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H38O8/c1-18(11-12-21-20(3)10-7-14-28(21,4)5)8-6-9-19(2)13-15-34-23(31)17-35-26-24(32)27(33)36-25(26)22(30)16-29/h6,8-9,11-13,22,25,29-30,32H,7,10,14-17H2,1-5H3/b9-6+,12-11+,18-8+,19-13+ |
| InChIKey | VJYZQEQXLDRKKX-IRHGQBOFSA-N |
| XLogP | 4.13 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|