About (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one
(3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one (PubChem CID 11756205) has the molecular formula C11H14Br4O3
and a molecular weight of 513.85 g/mol. Its IUPAC name is (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one.
Molecular Properties
| Compound Name | (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one |
| PubChem CID | 11756205 |
| Molecular Formula | C11H14Br4O3 |
| Molecular Weight | 513.85 g/mol |
| Exact Mass | 509.77 |
| IUPAC Name | (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one |
| SMILES | C/C(Br)=C1/C(=O)OCC1C(Br)COCC(Br)CBr |
| InChI | InChI=1S/C11H14Br4O3/c1-6(13)10-8(4-18-11(10)16)9(15)5-17-3-7(14)2-12/h7-9H,2-5H2,1H3/b10-6- |
| InChIKey | BWFHMGQDBBPPGC-POHAHGRESA-N |
| XLogP | 3.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one?
The IUPAC name of (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one (CID 11756205) is (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one.
What is the SMILES notation for (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one?
The canonical SMILES for (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one is C/C(Br)=C1/C(=O)OCC1C(Br)COCC(Br)CBr.
What is the InChIKey of (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one?
The InChIKey is BWFHMGQDBBPPGC-POHAHGRESA-N. The full InChI is InChI=1S/C11H14Br4O3/c1-6(13)10-8(4-18-11(10)16)9(15)5-17-3-7(14)2-12/h7-9H,2-5H2,1H3/b10-6-.
What are the key properties of (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one?
(3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one has a molecular weight of 513.85 g/mol, XLogP of 3.77, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-[1-bromo-2-(2,3-dibromopropoxy)ethyl]-3-(1-bromoethylidene)oxolan-2-one is sourced from PubChem (CID 11756205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).