C28H36F2N4OS — CID 11756225
3-(2,4-difluorophenyl)-1-heptyl-1-[5-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea (PubChem CID 11756225) has the molecular formula C28H36F2N4OS and a molecular weight of 514.69 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-heptyl-1-[5-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea.
| Compound Name | 3-(2,4-difluorophenyl)-1-heptyl-1-[5-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea |
|---|---|
| PubChem CID | 11756225 |
| Molecular Formula | C28H36F2N4OS |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-heptyl-1-[5-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea |
| SMILES | CCCCCCCN(CCCCCSc1ncc(-c2ccccc2)[nH]1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C28H36F2N4OS/c1-2-3-4-5-10-17-34(28(35)33-25-16-15-23(29)20-24(25)30)18-11-7-12-19-36-27-31-21-26(32-27)22-13-8-6-9-14-22/h6,8-9,13-16,20-21H,2-5,7,10-12,17-19H2,1H3,(H,31,32)(H,33,35) |
| InChIKey | VXOLOMVFGYQIDM-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|