C28H20N6O5 — CID 11756420
3-[2-[4-[[5-(6,8,10-trioxo-1,7,9-triazaspiro[4.5]decan-1-yl)-2-pyridinyl]oxy]phenyl]-1,3-oxazol-4-yl]benzonitrile (PubChem CID 11756420) has the molecular formula C28H20N6O5 and a molecular weight of 520.51 g/mol. Its IUPAC name is 3-[2-[4-[[5-(6,8,10-trioxo-1,7,9-triazaspiro[4.5]decan-1-yl)-2-pyridinyl]oxy]phenyl]-1,3-oxazol-4-yl]benzonitrile.
| Compound Name | 3-[2-[4-[[5-(6,8,10-trioxo-1,7,9-triazaspiro[4.5]decan-1-yl)-2-pyridinyl]oxy]phenyl]-1,3-oxazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 11756420 |
| Molecular Formula | C28H20N6O5 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 3-[2-[4-[[5-(6,8,10-trioxo-1,7,9-triazaspiro[4.5]decan-1-yl)-2-pyridinyl]oxy]phenyl]-1,3-oxazol-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2coc(-c3ccc(Oc4ccc(N5CCCC56C(=O)NC(=O)NC6=O)cn4)cc3)n2)c1 |
| InChI | InChI=1S/C28H20N6O5/c29-14-17-3-1-4-19(13-17)22-16-38-24(31-22)18-5-8-21(9-6-18)39-23-10-7-20(15-30-23)34-12-2-11-28(34)25(35)32-27(37)33-26(28)36/h1,3-10,13,15-16H,2,11-12H2,(H2,32,33,35,36,37) |
| InChIKey | BIPRBNGRDMIZHW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|