C30H43N5OS — CID 11756483
1-[2-(diethylamino)ethyl]-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea (PubChem CID 11756483) has the molecular formula C30H43N5OS and a molecular weight of 521.78 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-(diethylamino)ethyl]-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 11756483 |
| Molecular Formula | C30H43N5OS |
| Molecular Weight | 521.78 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-propan-2-ylurea |
| SMILES | CCN(CC)CCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)NC(C)C |
| InChI | InChI=1S/C30H43N5OS/c1-5-34(6-2)21-22-35(30(36)31-24(3)4)20-14-9-15-23-37-29-32-27(25-16-10-7-11-17-25)28(33-29)26-18-12-8-13-19-26/h7-8,10-13,16-19,24H,5-6,9,14-15,20-23H2,1-4H3,(H,31,36)(H,32,33) |
| InChIKey | VOQCKBYOYJSLMN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.78 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|