C16H13Br3O6 — CID 11757071
2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoic acid (PubChem CID 11757071) has the molecular formula C16H13Br3O6 and a molecular weight of 540.99 g/mol. Its IUPAC name is 2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoic acid.
| Compound Name | 2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 11757071 |
| Molecular Formula | C16H13Br3O6 |
| Molecular Weight | 540.99 g/mol |
| Exact Mass | 537.83 |
| IUPAC Name | 2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoic acid |
| SMILES | COc1c(O)cc(C(Cc2cc(O)c(O)c(Br)c2Br)C(=O)O)cc1Br |
| InChI | InChI=1S/C16H13Br3O6/c1-25-15-9(17)3-6(4-11(15)21)8(16(23)24)2-7-5-10(20)14(22)13(19)12(7)18/h3-5,8,20-22H,2H2,1H3,(H,23,24) |
| InChIKey | FUZVJQBFHDTDIO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|