C34H37NO6 — CID 11757409
ethyl 7-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-4-oxochromene-2-carboxylate (PubChem CID 11757409) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is ethyl 7-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 7-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 11757409 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | ethyl 7-[4-(4-benzhydryloxypiperidin-1-yl)butoxy]-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2ccc(OCCCCN3CCC(OC(c4ccccc4)c4ccccc4)CC3)cc2o1 |
| InChI | InChI=1S/C34H37NO6/c1-2-38-34(37)32-24-30(36)29-16-15-28(23-31(29)41-32)39-22-10-9-19-35-20-17-27(18-21-35)40-33(25-11-5-3-6-12-25)26-13-7-4-8-14-26/h3-8,11-16,23-24,27,33H,2,9-10,17-22H2,1H3 |
| InChIKey | QTSHWZZGJSOZPU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|