C26H19F7N2O4 — CID 11757422
2-[(4-fluorophenyl)methyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6,7-dimethoxyquinazolin-4-one (PubChem CID 11757422) has the molecular formula C26H19F7N2O4 and a molecular weight of 556.43 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6,7-dimethoxyquinazolin-4-one.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6,7-dimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 11757422 |
| Molecular Formula | C26H19F7N2O4 |
| Molecular Weight | 556.43 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-6,7-dimethoxyquinazolin-4-one |
| SMILES | COc1cc2nc(Cc3ccc(F)cc3)n(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C26H19F7N2O4/c1-38-20-12-18-19(13-21(20)39-2)34-22(11-14-3-7-16(27)8-4-14)35(23(18)36)17-9-5-15(6-10-17)24(37,25(28,29)30)26(31,32)33/h3-10,12-13,37H,11H2,1-2H3 |
| InChIKey | UWWJROVKRSKHSU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |