C30H36NO10+ — CID 11757735
[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-trimethylazanium (PubChem CID 11757735) has the molecular formula C30H36NO10+ and a molecular weight of 570.62 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-trimethylazanium.
| Compound Name | [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-trimethylazanium |
|---|---|
| PubChem CID | 11757735 |
| Molecular Formula | C30H36NO10+ |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-trimethylazanium |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3O[C@H]1C[C@H]([N+](C)(C)C)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C30H35NO10/c1-13-25(33)17(31(3,4)5)10-20(40-13)41-19-12-30(38,14(2)32)11-16-22(19)29(37)24-23(27(16)35)26(34)15-8-7-9-18(39-6)21(15)28(24)36/h7-9,13,17,19-20,25,33,38H,10-12H2,1-6H3,(H-,34,35,36,37)/p+1/t13-,17-,19-,20-,25+,30-/m0/s1 |
| InChIKey | COYCQUYRQRSTMQ-IIVDXZBSSA-O |
| XLogP | 1.78 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|