C35H44O7 — CID 11757880
(2S,3S,4S,5R,6S)-4-heptoxy-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)oxane-2-carbaldehyde (PubChem CID 11757880) has the molecular formula C35H44O7 and a molecular weight of 576.73 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-4-heptoxy-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)oxane-2-carbaldehyde.
| Compound Name | (2S,3S,4S,5R,6S)-4-heptoxy-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 11757880 |
| Molecular Formula | C35H44O7 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (2S,3S,4S,5R,6S)-4-heptoxy-3-[(4-methoxyphenyl)methoxy]-5,6-bis(phenylmethoxy)oxane-2-carbaldehyde |
| SMILES | CCCCCCCO[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)O[C@H](C=O)[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C35H44O7/c1-3-4-5-6-13-22-38-33-32(39-25-29-18-20-30(37-2)21-19-29)31(23-36)42-35(41-26-28-16-11-8-12-17-28)34(33)40-24-27-14-9-7-10-15-27/h7-12,14-21,23,31-35H,3-6,13,22,24-26H2,1-2H3/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | BMBDBCLALLKEQG-KJQSSVQNSA-N |
| XLogP | 6.66 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|