C29H42O12 — CID 11757982
methyl 3,5-bis(3-methylbut-2-enyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxybenzoate (PubChem CID 11757982) has the molecular formula C29H42O12 and a molecular weight of 582.64 g/mol. Its IUPAC name is methyl 3,5-bis(3-methylbut-2-enyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxybenzoate.
| Compound Name | methyl 3,5-bis(3-methylbut-2-enyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 11757982 |
| Molecular Formula | C29H42O12 |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | methyl 3,5-bis(3-methylbut-2-enyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxybenzoate |
| SMILES | COC(=O)c1cc(CC=C(C)C)c(O[C@@H]2O[C@H](CO[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)c(CC=C(C)C)c1 |
| InChI | InChI=1S/C29H42O12/c1-14(2)6-8-16-10-18(27(36)37-5)11-17(9-7-15(3)4)26(16)41-29-25(35)23(33)22(32)20(40-29)13-39-28-24(34)21(31)19(30)12-38-28/h6-7,10-11,19-25,28-35H,8-9,12-13H2,1-5H3/t19-,20-,21+,22-,23+,24-,25-,28+,29+/m1/s1 |
| InChIKey | HGHZRURULHCRHQ-WZLWUFTHSA-N |
| XLogP | 0.13 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|