C23H21F3N2O7S3 — CID 11758137
N-[(1S)-1-[4-[4-cyclopropyl-2-(1-oxidopyridin-1-ium-2-yl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 11758137) has the molecular formula C23H21F3N2O7S3 and a molecular weight of 590.62 g/mol. Its IUPAC name is N-[(1S)-1-[4-[4-cyclopropyl-2-(1-oxidopyridin-1-ium-2-yl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(1S)-1-[4-[4-cyclopropyl-2-(1-oxidopyridin-1-ium-2-yl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 11758137 |
| Molecular Formula | C23H21F3N2O7S3 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.05 |
| IUPAC Name | N-[(1S)-1-[4-[4-cyclopropyl-2-(1-oxidopyridin-1-ium-2-yl)sulfonylphenyl]sulfonylphenyl]ethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)C(F)(F)F)c1ccc(S(=O)(=O)c2ccc(C3CC3)cc2S(=O)(=O)c2cccc[n+]2[O-])cc1 |
| InChI | InChI=1S/C23H21F3N2O7S3/c1-15(27-38(34,35)23(24,25)26)16-7-10-19(11-8-16)36(30,31)20-12-9-18(17-5-6-17)14-21(20)37(32,33)22-4-2-3-13-28(22)29/h2-4,7-15,17,27H,5-6H2,1H3/t15-/m0/s1 |
| InChIKey | ZXWFUMURXRZZGX-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|