About (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine
(E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine (PubChem CID 11758645) has the molecular formula C20H24N2O
and a molecular weight of 308.43 g/mol. Its IUPAC name is (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine.
Molecular Properties
| Compound Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine |
| PubChem CID | 11758645 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine |
| SMILES | COC[C@@H]1CCCN1/N=C(\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O/c1-23-16-19-13-8-14-22(19)21-20(18-11-6-3-7-12-18)15-17-9-4-2-5-10-17/h2-7,9-12,19H,8,13-16H2,1H3/b21-20+/t19-/m0/s1 |
| InChIKey | PLSCEAJGCPBUDL-GEXZYOHASA-N |
| XLogP | 3.74 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine?
The IUPAC name of (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine (CID 11758645) is (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine.
What is the SMILES notation for (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine?
The canonical SMILES for (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine is COC[C@@H]1CCCN1/N=C(\Cc1ccccc1)c1ccccc1.
What is the InChIKey of (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine?
The InChIKey is PLSCEAJGCPBUDL-GEXZYOHASA-N. The full InChI is InChI=1S/C20H24N2O/c1-23-16-19-13-8-14-22(19)21-20(18-11-6-3-7-12-18)15-17-9-4-2-5-10-17/h2-7,9-12,19H,8,13-16H2,1H3/b21-20+/t19-/m0/s1.
What are the key properties of (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine?
(E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine has a molecular weight of 308.43 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylethanimine is sourced from PubChem (CID 11758645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).