About tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane
tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane (PubChem CID 11758727) has the molecular formula C18H34O2Si
and a molecular weight of 310.55 g/mol. Its IUPAC name is tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane.
Molecular Properties
| Compound Name | tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane |
| PubChem CID | 11758727 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane |
| SMILES | CCCC[Si](CCCC)(CCCC)O[C@@H]1C=C[C@@]2(CO2)C1 |
| InChI | InChI=1S/C18H34O2Si/c1-4-7-12-21(13-8-5-2,14-9-6-3)20-17-10-11-18(15-17)16-19-18/h10-11,17H,4-9,12-16H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | YFPUBAQQQYQQNE-MSOLQXFVSA-N |
| XLogP | 5.45 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane?
The IUPAC name of tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane (CID 11758727) is tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane.
What is the SMILES notation for tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane?
The canonical SMILES for tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane is CCCC[Si](CCCC)(CCCC)O[C@@H]1C=C[C@@]2(CO2)C1.
What is the InChIKey of tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane?
The InChIKey is YFPUBAQQQYQQNE-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H34O2Si/c1-4-7-12-21(13-8-5-2,14-9-6-3)20-17-10-11-18(15-17)16-19-18/h10-11,17H,4-9,12-16H2,1-3H3/t17-,18+/m1/s1.
What are the key properties of tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane?
tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane has a molecular weight of 310.55 g/mol, XLogP of 5.45, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[[(3R,6S)-1-oxaspiro[2.4]hept-4-en-6-yl]oxy]silane is sourced from PubChem (CID 11758727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).