C19H23NO3 — CID 11758796
(2E,4E,6E)-3,7-dimethyl-8-oxo-8-(2,4,6-trimethylanilino)octa-2,4,6-trienoic acid (PubChem CID 11758796) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2E,4E,6E)-3,7-dimethyl-8-oxo-8-(2,4,6-trimethylanilino)octa-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-3,7-dimethyl-8-oxo-8-(2,4,6-trimethylanilino)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 11758796 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2E,4E,6E)-3,7-dimethyl-8-oxo-8-(2,4,6-trimethylanilino)octa-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C(\C)C(=O)Nc1c(C)cc(C)cc1C)=C\C(=O)O |
| InChI | InChI=1S/C19H23NO3/c1-12(11-17(21)22)7-6-8-14(3)19(23)20-18-15(4)9-13(2)10-16(18)5/h6-11H,1-5H3,(H,20,23)(H,21,22)/b7-6+,12-11+,14-8+ |
| InChIKey | UIUBMZXDAWORTQ-HUJWONBPSA-N |
| XLogP | 4.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|