C16H14O7 — CID 11758945
dimethyl (1R,9R)-1-methoxy-8-oxo-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-10,11-dicarboxylate (PubChem CID 11758945) has the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. Its IUPAC name is dimethyl (1R,9R)-1-methoxy-8-oxo-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-10,11-dicarboxylate.
| Compound Name | dimethyl (1R,9R)-1-methoxy-8-oxo-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 11758945 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | dimethyl (1R,9R)-1-methoxy-8-oxo-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraene-10,11-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(OC)O[C@H]1C(=O)c1ccccc12 |
| InChI | InChI=1S/C16H14O7/c1-20-14(18)10-11(15(19)21-2)16(22-3)9-7-5-4-6-8(9)12(17)13(10)23-16/h4-7,13H,1-3H3/t13-,16-/m1/s1 |
| InChIKey | CRGBBKZFDQNMTA-CZUORRHYSA-N |
| XLogP | 0.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |