C19H18FNO3 — CID 11759217
(3S,3aS,6S,6aS)-1-benzyl-6-(fluoromethyl)-3-phenyl-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one (PubChem CID 11759217) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is (3S,3aS,6S,6aS)-1-benzyl-6-(fluoromethyl)-3-phenyl-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one.
| Compound Name | (3S,3aS,6S,6aS)-1-benzyl-6-(fluoromethyl)-3-phenyl-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 11759217 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (3S,3aS,6S,6aS)-1-benzyl-6-(fluoromethyl)-3-phenyl-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
| SMILES | O=C1O[C@H](CF)[C@@H]2[C@H]1[C@@H](c1ccccc1)ON2Cc1ccccc1 |
| InChI | InChI=1S/C19H18FNO3/c20-11-15-17-16(19(22)23-15)18(14-9-5-2-6-10-14)24-21(17)12-13-7-3-1-4-8-13/h1-10,15-18H,11-12H2/t15-,16+,17-,18-/m1/s1 |
| InChIKey | UZZPLZHDGOURJF-XMTFNYHQSA-N |
| XLogP | 3.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |