About 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide
2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide (PubChem CID 11759296) has the molecular formula C13H20BrN3O2
and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide.
Molecular Properties
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide |
| PubChem CID | 11759296 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide |
| SMILES | C=CC[N+](C)(CC=C)CCn1ccc(=O)[nH]c1=O.[Br-] |
| InChI | InChI=1S/C13H19N3O2.BrH/c1-4-9-16(3,10-5-2)11-8-15-7-6-12(17)14-13(15)18;/h4-7H,1-2,8-11H2,3H3;1H |
| InChIKey | UAIYMFXHIKCWGX-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide?
The IUPAC name of 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide (CID 11759296) is 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide.
What is the SMILES notation for 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide?
The canonical SMILES for 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide is C=CC[N+](C)(CC=C)CCn1ccc(=O)[nH]c1=O.[Br-].
What is the InChIKey of 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide?
The InChIKey is UAIYMFXHIKCWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2.BrH/c1-4-9-16(3,10-5-2)11-8-15-7-6-12(17)14-13(15)18;/h4-7H,1-2,8-11H2,3H3;1H.
What are the key properties of 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide?
2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide has a molecular weight of 330.23 g/mol, XLogP of -2.64, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxopyrimidin-1-yl)ethyl-methyl-bis(prop-2-enyl)azanium bromide is sourced from PubChem (CID 11759296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).