About 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one
5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one (PubChem CID 11759310) has the molecular formula C20H26O4
and a molecular weight of 330.42 g/mol. Its IUPAC name is 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one.
Molecular Properties
| Compound Name | 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one |
| PubChem CID | 11759310 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one |
| SMILES | CCC(=O)C1=C(O)C2=C(OC(C)(C)C=C2)C(C)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C20H26O4/c1-7-14(21)15-16(22)13-9-10-19(4,5)24-18(13)20(6,17(15)23)11-8-12(2)3/h8-10,22H,7,11H2,1-6H3 |
| InChIKey | DKHGNFGXIABPML-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one?
The IUPAC name of 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one (CID 11759310) is 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one.
What is the SMILES notation for 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one?
The canonical SMILES for 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one is CCC(=O)C1=C(O)C2=C(OC(C)(C)C=C2)C(C)(CC=C(C)C)C1=O.
What is the InChIKey of 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one?
The InChIKey is DKHGNFGXIABPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O4/c1-7-14(21)15-16(22)13-9-10-19(4,5)24-18(13)20(6,17(15)23)11-8-12(2)3/h8-10,22H,7,11H2,1-6H3.
What are the key properties of 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one?
5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one has a molecular weight of 330.42 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,2,8-trimethyl-8-(3-methylbut-2-enyl)-6-propanoylchromen-7-one is sourced from PubChem (CID 11759310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).