About carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one
carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one (PubChem CID 11759383) has the molecular formula C14H15FeNO5
and a molecular weight of 333.12 g/mol. Its IUPAC name is carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one.
Molecular Properties
| Compound Name | carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one |
| PubChem CID | 11759383 |
| Molecular Formula | C14H15FeNO5 |
| Molecular Weight | 333.12 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one |
| SMILES | COC1=CCC2(C=C1)CCCNC2=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C11H15NO2.3CO.Fe/c1-14-9-3-6-11(7-4-9)5-2-8-12-10(11)13;3*1-2;/h3-4,6H,2,5,7-8H2,1H3,(H,12,13);;;; |
| InChIKey | XOKQQUJKGYLYLR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.12 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one?
The IUPAC name of carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one (CID 11759383) is carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one.
What is the SMILES notation for carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one?
The canonical SMILES for carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one is COC1=CCC2(C=C1)CCCNC2=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe].
What is the InChIKey of carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one?
The InChIKey is XOKQQUJKGYLYLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.3CO.Fe/c1-14-9-3-6-11(7-4-9)5-2-8-12-10(11)13;3*1-2;/h3-4,6H,2,5,7-8H2,1H3,(H,12,13);;;;.
What are the key properties of carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one?
carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one has a molecular weight of 333.12 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;iron;9-methoxy-2-azaspiro[5.5]undeca-8,10-dien-1-one is sourced from PubChem (CID 11759383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).