About [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate
[3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate (PubChem CID 11759503) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate.
Molecular Properties
| Compound Name | [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate |
| PubChem CID | 11759503 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate |
| SMILES | C#CCN(C)C1CCc2ccc(OC(=O)N(C)CCC)cc21 |
| InChI | InChI=1S/C18H24N2O2/c1-5-11-19(3)17-10-8-14-7-9-15(13-16(14)17)22-18(21)20(4)12-6-2/h1,7,9,13,17H,6,8,10-12H2,2-4H3 |
| InChIKey | DOCKMKZFEVDKQI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate?
The IUPAC name of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate (CID 11759503) is [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate.
What is the SMILES notation for [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate?
The canonical SMILES for [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate is C#CCN(C)C1CCc2ccc(OC(=O)N(C)CCC)cc21.
What is the InChIKey of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate?
The InChIKey is DOCKMKZFEVDKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-5-11-19(3)17-10-8-14-7-9-15(13-16(14)17)22-18(21)20(4)12-6-2/h1,7,9,13,17H,6,8,10-12H2,2-4H3.
What are the key properties of [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate?
[3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate has a molecular weight of 300.40 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[methyl(prop-2-ynyl)amino]-2,3-dihydro-1H-inden-5-yl] N-methyl-N-propylcarbamate is sourced from PubChem (CID 11759503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).