About (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene
(5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene (PubChem CID 11759573) has the molecular formula C13H17BrF2OS
and a molecular weight of 339.25 g/mol. Its IUPAC name is (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene.
Molecular Properties
| Compound Name | (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene |
| PubChem CID | 11759573 |
| Molecular Formula | C13H17BrF2OS |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene |
| SMILES | CS(=O)C(F)(F)C(Br)CCCCc1ccccc1 |
| InChI | InChI=1S/C13H17BrF2OS/c1-18(17)13(15,16)12(14)10-6-5-9-11-7-3-2-4-8-11/h2-4,7-8,12H,5-6,9-10H2,1H3 |
| InChIKey | NTUNVGAQWVMWAR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene?
The IUPAC name of (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene (CID 11759573) is (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene.
What is the SMILES notation for (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene?
The canonical SMILES for (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene is CS(=O)C(F)(F)C(Br)CCCCc1ccccc1.
What is the InChIKey of (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene?
The InChIKey is NTUNVGAQWVMWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrF2OS/c1-18(17)13(15,16)12(14)10-6-5-9-11-7-3-2-4-8-11/h2-4,7-8,12H,5-6,9-10H2,1H3.
What are the key properties of (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene?
(5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene has a molecular weight of 339.25 g/mol, XLogP of 4.13, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-6,6-difluoro-6-methylsulfinylhexyl)benzene is sourced from PubChem (CID 11759573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).