C20H26O5 — CID 11759836
[4-[(2E)-3,7-dimethyl(114C)octa-2,6-dienyl]-2-methoxy-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate (PubChem CID 11759836) has the molecular formula C20H26O5 and a molecular weight of 348.42 g/mol. Its IUPAC name is [4-[(2E)-3,7-dimethyl(114C)octa-2,6-dienyl]-2-methoxy-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate.
| Compound Name | [4-[(2E)-3,7-dimethyl(114C)octa-2,6-dienyl]-2-methoxy-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 11759836 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [4-[(2E)-3,7-dimethyl(114C)octa-2,6-dienyl]-2-methoxy-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate |
| SMILES | COC1=C(OC(C)=O)C(=O)C(C)=C([14CH2]/C=C(\C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C20H26O5/c1-12(2)8-7-9-13(3)10-11-16-14(4)17(22)20(25-15(5)21)19(24-6)18(16)23/h8,10H,7,9,11H2,1-6H3/b13-10+/i11+2 |
| InChIKey | QFMOAQDQOWWRCT-GSRQFGOCSA-N |
| XLogP | 3.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|