C19H9F3N2O2 — CID 11759995
17-(trifluoromethyl)-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione (PubChem CID 11759995) has the molecular formula C19H9F3N2O2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 17-(trifluoromethyl)-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione.
| Compound Name | 17-(trifluoromethyl)-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione |
|---|---|
| PubChem CID | 11759995 |
| Molecular Formula | C19H9F3N2O2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 17-(trifluoromethyl)-4,14-diazapentacyclo[11.7.0.02,6.07,12.015,20]icosa-1(13),2(6),7,9,11,15(20),16,18-octaene-3,5-dione |
| SMILES | O=C1NC(=O)c2c1c1ccccc1c1[nH]c3cc(C(F)(F)F)ccc3c21 |
| InChI | InChI=1S/C19H9F3N2O2/c20-19(21,22)8-5-6-11-12(7-8)23-16-10-4-2-1-3-9(10)14-15(13(11)16)18(26)24-17(14)25/h1-7,23H,(H,24,25,26) |
| InChIKey | QQLGFAZNPMWUAB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|