About 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one
3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one (PubChem CID 11760063) has the molecular formula C20H20O6
and a molecular weight of 356.37 g/mol. Its IUPAC name is 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one.
Molecular Properties
| Compound Name | 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one |
| PubChem CID | 11760063 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one |
| SMILES | COc1ccc(C2=C(c3ccc(OC)c(OC)c3)C(=O)OC2)cc1OC |
| InChI | InChI=1S/C20H20O6/c1-22-15-7-5-12(9-17(15)24-3)14-11-26-20(21)19(14)13-6-8-16(23-2)18(10-13)25-4/h5-10H,11H2,1-4H3 |
| InChIKey | FGMQIGBHXSBGMS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one?
The IUPAC name of 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one (CID 11760063) is 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one.
What is the SMILES notation for 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one?
The canonical SMILES for 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one is COc1ccc(C2=C(c3ccc(OC)c(OC)c3)C(=O)OC2)cc1OC.
What is the InChIKey of 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one?
The InChIKey is FGMQIGBHXSBGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O6/c1-22-15-7-5-12(9-17(15)24-3)14-11-26-20(21)19(14)13-6-8-16(23-2)18(10-13)25-4/h5-10H,11H2,1-4H3.
What are the key properties of 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one?
3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one has a molecular weight of 356.37 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(3,4-dimethoxyphenyl)-2H-furan-5-one is sourced from PubChem (CID 11760063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).